C10H16N5O4+ — CID 135788875
dihydroxy(oxo)azanium;2-[(E)-1-(4-hydroxyphenyl)propylideneamino]guanidine (PubChem CID 135788875) has the molecular formula C10H16N5O4+ and a molecular weight of 270.27 g/mol. Its IUPAC name is dihydroxy(oxo)azanium;2-[(E)-1-(4-hydroxyphenyl)propylideneamino]guanidine.
| Compound Name | dihydroxy(oxo)azanium;2-[(E)-1-(4-hydroxyphenyl)propylideneamino]guanidine |
|---|---|
| PubChem CID | 135788875 |
| Molecular Formula | C10H16N5O4+ |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | dihydroxy(oxo)azanium;2-[(E)-1-(4-hydroxyphenyl)propylideneamino]guanidine |
| SMILES | CC/C(=N\N=C(N)N)c1ccc(O)cc1.O=[N+](O)O |
| InChI | InChI=1S/C10H14N4O.H2NO3/c1-2-9(13-14-10(11)12)7-3-5-8(15)6-4-7;2-1(3)4/h3-6,15H,2H2,1H3,(H4,11,12,14);(H2,2,3,4)/q;+1/b13-9+; |
| InChIKey | ZWOAMFQINLBEJZ-KJEVSKRMSA-N |
| XLogP | 0.32 |
| TPSA | 157.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|