C17H21N5O4 — CID 45049782
nitric acid;2-[(E)-1-(4-phenylmethoxyphenyl)propylideneamino]guanidine (PubChem CID 45049782) has the molecular formula C17H21N5O4 and a molecular weight of 359.39 g/mol. Its IUPAC name is nitric acid;2-[(E)-1-(4-phenylmethoxyphenyl)propylideneamino]guanidine.
| Compound Name | nitric acid;2-[(E)-1-(4-phenylmethoxyphenyl)propylideneamino]guanidine |
|---|---|
| PubChem CID | 45049782 |
| Molecular Formula | C17H21N5O4 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | nitric acid;2-[(E)-1-(4-phenylmethoxyphenyl)propylideneamino]guanidine |
| SMILES | CC/C(=N\N=C(N)N)c1ccc(OCc2ccccc2)cc1.O=[N+]([O-])O |
| InChI | InChI=1S/C17H20N4O.HNO3/c1-2-16(20-21-17(18)19)14-8-10-15(11-9-14)22-12-13-6-4-3-5-7-13;2-1(3)4/h3-11H,2,12H2,1H3,(H4,18,19,21);(H,2,3,4)/b20-16+; |
| InChIKey | IMYYFVJGWFEMHQ-QTNJPTFUSA-N |
| XLogP | 2.31 |
| TPSA | 149.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|