C19H23N5O — CID 178024650
2-[(Z)-[(1-amino-2-methylcyclopropyl)-(4-phenylmethoxyphenyl)methylidene]amino]guanidine (PubChem CID 178024650) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is 2-[(Z)-[(1-amino-2-methylcyclopropyl)-(4-phenylmethoxyphenyl)methylidene]amino]guanidine.
| Compound Name | 2-[(Z)-[(1-amino-2-methylcyclopropyl)-(4-phenylmethoxyphenyl)methylidene]amino]guanidine |
|---|---|
| PubChem CID | 178024650 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 2-[(Z)-[(1-amino-2-methylcyclopropyl)-(4-phenylmethoxyphenyl)methylidene]amino]guanidine |
| SMILES | CC1CC1(N)/C(=N\N=C(N)N)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H23N5O/c1-13-11-19(13,22)17(23-24-18(20)21)15-7-9-16(10-8-15)25-12-14-5-3-2-4-6-14/h2-10,13H,11-12,22H2,1H3,(H4,20,21,24)/b23-17- |
| InChIKey | SMRHXQGXOHPFIE-QJOMJCCJSA-N |
| XLogP | 1.98 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|