C13H14N4O4S — CID 168573860
2-[(2-hydroxy-3-nitro-5-propan-2-ylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 168573860) has the molecular formula C13H14N4O4S and a molecular weight of 322.35 g/mol. Its IUPAC name is 2-[(2-hydroxy-3-nitro-5-propan-2-ylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[(2-hydroxy-3-nitro-5-propan-2-ylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 168573860 |
| Molecular Formula | C13H14N4O4S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 2-[(2-hydroxy-3-nitro-5-propan-2-ylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | CC(C)c1cc(C=NN=C2NC(=O)CS2)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H14N4O4S/c1-7(2)8-3-9(12(19)10(4-8)17(20)21)5-14-16-13-15-11(18)6-22-13/h3-5,7,19H,6H2,1-2H3,(H,15,16,18) |
| InChIKey | DWLWDSLXMREHSL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 117.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|