C10H7N4O4S- — CID 135851503
4-nitro-2-[(Z)-[(Z)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenolate (PubChem CID 135851503) has the molecular formula C10H7N4O4S- and a molecular weight of 279.26 g/mol. Its IUPAC name is 4-nitro-2-[(Z)-[(Z)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenolate.
| Compound Name | 4-nitro-2-[(Z)-[(Z)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenolate |
|---|---|
| PubChem CID | 135851503 |
| Molecular Formula | C10H7N4O4S- |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 4-nitro-2-[(Z)-[(Z)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenolate |
| SMILES | O=C1CS/C(=N\N=C/c2cc([N+](=O)[O-])ccc2[O-])N1 |
| InChI | InChI=1S/C10H8N4O4S/c15-8-2-1-7(14(17)18)3-6(8)4-11-13-10-12-9(16)5-19-10/h1-4,15H,5H2,(H,12,13,16)/p-1/b11-4- |
| InChIKey | ANHXICUXPQQMPD-WCIBSUBMSA-M |
| XLogP | 0.22 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|