C16H11FN4O3S2 — CID 168574539
2-[[2-(4-fluorophenyl)sulfanyl-5-nitrophenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 168574539) has the molecular formula C16H11FN4O3S2 and a molecular weight of 390.42 g/mol. Its IUPAC name is 2-[[2-(4-fluorophenyl)sulfanyl-5-nitrophenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[[2-(4-fluorophenyl)sulfanyl-5-nitrophenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 168574539 |
| Molecular Formula | C16H11FN4O3S2 |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 2-[[2-(4-fluorophenyl)sulfanyl-5-nitrophenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(=NN=Cc2cc([N+](=O)[O-])ccc2Sc2ccc(F)cc2)N1 |
| InChI | InChI=1S/C16H11FN4O3S2/c17-11-1-4-13(5-2-11)26-14-6-3-12(21(23)24)7-10(14)8-18-20-16-19-15(22)9-25-16/h1-8H,9H2,(H,19,20,22) |
| InChIKey | KBUMAPYPQSLDTN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 96.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|