C10H9BFN3O3S — CID 168574608
[4-fluoro-2-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl]boronic acid (PubChem CID 168574608) has the molecular formula C10H9BFN3O3S and a molecular weight of 281.08 g/mol. Its IUPAC name is [4-fluoro-2-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl]boronic acid.
| Compound Name | [4-fluoro-2-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 168574608 |
| Molecular Formula | C10H9BFN3O3S |
| Molecular Weight | 281.08 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | [4-fluoro-2-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl]boronic acid |
| SMILES | O=C1CSC(=NN=Cc2cc(F)ccc2B(O)O)N1 |
| InChI | InChI=1S/C10H9BFN3O3S/c12-7-1-2-8(11(17)18)6(3-7)4-13-15-10-14-9(16)5-19-10/h1-4,17-18H,5H2,(H,14,15,16) |
| InChIKey | KVMHEICDGJLFER-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.08 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|