C10H8BF2N3O3S — CID 168574463
[2,3-difluoro-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl]boronic acid (PubChem CID 168574463) has the molecular formula C10H8BF2N3O3S and a molecular weight of 299.07 g/mol. Its IUPAC name is [2,3-difluoro-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl]boronic acid.
| Compound Name | [2,3-difluoro-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 168574463 |
| Molecular Formula | C10H8BF2N3O3S |
| Molecular Weight | 299.07 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | [2,3-difluoro-4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl]boronic acid |
| SMILES | O=C1CSC(=NN=Cc2ccc(B(O)O)c(F)c2F)N1 |
| InChI | InChI=1S/C10H8BF2N3O3S/c12-8-5(1-2-6(9(8)13)11(18)19)3-14-16-10-15-7(17)4-20-10/h1-3,18-19H,4H2,(H,15,16,17) |
| InChIKey | SPLKIVMJZIDYLD-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.07 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|