C14H18N4O2S — CID 135463828
2-[[4-(diethylamino)-2-hydroxyphenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135463828) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is 2-[[4-(diethylamino)-2-hydroxyphenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[[4-(diethylamino)-2-hydroxyphenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135463828 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-[[4-(diethylamino)-2-hydroxyphenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | CCN(CC)c1ccc(C=NN=C2NC(=O)CS2)c(O)c1 |
| InChI | InChI=1S/C14H18N4O2S/c1-3-18(4-2)11-6-5-10(12(19)7-11)8-15-17-14-16-13(20)9-21-14/h5-8,19H,3-4,9H2,1-2H3,(H,16,17,20) |
| InChIKey | UCAXHSYXIWCGTP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|