C10H8N4O4S — CID 168576426
2-[(3-hydroxy-5-nitrophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 168576426) has the molecular formula C10H8N4O4S and a molecular weight of 280.26 g/mol. Its IUPAC name is 2-[(3-hydroxy-5-nitrophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[(3-hydroxy-5-nitrophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 168576426 |
| Molecular Formula | C10H8N4O4S |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2-[(3-hydroxy-5-nitrophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(=NN=Cc2cc(O)cc([N+](=O)[O-])c2)N1 |
| InChI | InChI=1S/C10H8N4O4S/c15-8-2-6(1-7(3-8)14(17)18)4-11-13-10-12-9(16)5-19-10/h1-4,15H,5H2,(H,12,13,16) |
| InChIKey | RQBJHJYHNLZGRQ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 117.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|