C13H12N4O4S — CID 162787788
ethyl 2-[2-[(2-nitrophenyl)methylidene]hydrazinyl]-1,3-thiazole-4-carboxylate (PubChem CID 162787788) has the molecular formula C13H12N4O4S and a molecular weight of 320.33 g/mol. Its IUPAC name is ethyl 2-[2-[(2-nitrophenyl)methylidene]hydrazinyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[2-[(2-nitrophenyl)methylidene]hydrazinyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 162787788 |
| Molecular Formula | C13H12N4O4S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | ethyl 2-[2-[(2-nitrophenyl)methylidene]hydrazinyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(NN=Cc2ccccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C13H12N4O4S/c1-2-21-12(18)10-8-22-13(15-10)16-14-7-9-5-3-4-6-11(9)17(19)20/h3-8H,2H2,1H3,(H,15,16) |
| InChIKey | DFCUYNITLOXGCQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 106.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|