C31H46N6O5S — CID 3264210
1-[2-[[[2-[bis(2-methylpropyl)sulfamoyl]-4-nitrophenyl]hydrazinylidene]methyl]phenyl]-N,N-diethylpiperidine-3-carboxamide (PubChem CID 3264210) has the molecular formula C31H46N6O5S and a molecular weight of 614.81 g/mol. Its IUPAC name is 1-[2-[[[2-[bis(2-methylpropyl)sulfamoyl]-4-nitrophenyl]hydrazinylidene]methyl]phenyl]-N,N-diethylpiperidine-3-carboxamide.
| Compound Name | 1-[2-[[[2-[bis(2-methylpropyl)sulfamoyl]-4-nitrophenyl]hydrazinylidene]methyl]phenyl]-N,N-diethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 3264210 |
| Molecular Formula | C31H46N6O5S |
| Molecular Weight | 614.81 g/mol |
| Exact Mass | 614.33 |
| IUPAC Name | 1-[2-[[[2-[bis(2-methylpropyl)sulfamoyl]-4-nitrophenyl]hydrazinylidene]methyl]phenyl]-N,N-diethylpiperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCCN(c2ccccc2C=NNc2ccc([N+](=O)[O-])cc2S(=O)(=O)N(CC(C)C)CC(C)C)C1 |
| InChI | InChI=1S/C31H46N6O5S/c1-7-34(8-2)31(38)26-13-11-17-35(22-26)29-14-10-9-12-25(29)19-32-33-28-16-15-27(37(39)40)18-30(28)43(41,42)36(20-23(3)4)21-24(5)6/h9-10,12,14-16,18-19,23-24,26,33H,7-8,11,13,17,20-22H2,1-6H3 |
| InChIKey | GIKUBILGXYMSLL-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.81 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|