C25H34N6O7S — CID 3662972
N,N-bis(2-methylpropyl)-2-[2-[(2-morpholin-4-yl-5-nitrophenyl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide (PubChem CID 3662972) has the molecular formula C25H34N6O7S and a molecular weight of 562.65 g/mol. Its IUPAC name is N,N-bis(2-methylpropyl)-2-[2-[(2-morpholin-4-yl-5-nitrophenyl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide.
| Compound Name | N,N-bis(2-methylpropyl)-2-[2-[(2-morpholin-4-yl-5-nitrophenyl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 3662972 |
| Molecular Formula | C25H34N6O7S |
| Molecular Weight | 562.65 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | N,N-bis(2-methylpropyl)-2-[2-[(2-morpholin-4-yl-5-nitrophenyl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide |
| SMILES | CC(C)CN(CC(C)C)S(=O)(=O)c1cc([N+](=O)[O-])ccc1NN=Cc1cc([N+](=O)[O-])ccc1N1CCOCC1 |
| InChI | InChI=1S/C25H34N6O7S/c1-18(2)16-29(17-19(3)4)39(36,37)25-14-22(31(34)35)5-7-23(25)27-26-15-20-13-21(30(32)33)6-8-24(20)28-9-11-38-12-10-28/h5-8,13-15,18-19,27H,9-12,16-17H2,1-4H3 |
| InChIKey | OIMBUDDGAWNEPD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 160.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.65 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|