C17H17N5O8S — CID 98095293
(2R)-4-(2,4-dinitrophenyl)-2-methyl-1-(3-nitrophenyl)sulfonylpiperazine (PubChem CID 98095293) has the molecular formula C17H17N5O8S and a molecular weight of 451.42 g/mol. Its IUPAC name is (2R)-4-(2,4-dinitrophenyl)-2-methyl-1-(3-nitrophenyl)sulfonylpiperazine.
| Compound Name | (2R)-4-(2,4-dinitrophenyl)-2-methyl-1-(3-nitrophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 98095293 |
| Molecular Formula | C17H17N5O8S |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | (2R)-4-(2,4-dinitrophenyl)-2-methyl-1-(3-nitrophenyl)sulfonylpiperazine |
| SMILES | C[C@@H]1CN(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CCN1S(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H17N5O8S/c1-12-11-18(16-6-5-14(21(25)26)10-17(16)22(27)28)7-8-19(12)31(29,30)15-4-2-3-13(9-15)20(23)24/h2-6,9-10,12H,7-8,11H2,1H3/t12-/m1/s1 |
| InChIKey | FKNGYEQSRPKRRR-GFCCVEGCSA-N |
| XLogP | 2.31 |
| TPSA | 170.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|