C18H21ClN4O5 — CID 44657302
1-cyclopropyl-7-(3-methylpiperazin-4-ium-1-yl)-6-nitro-4-oxoquinoline-3-carboxylic acid chloride (PubChem CID 44657302) has the molecular formula C18H21ClN4O5 and a molecular weight of 408.84 g/mol. Its IUPAC name is 1-cyclopropyl-7-(3-methylpiperazin-4-ium-1-yl)-6-nitro-4-oxoquinoline-3-carboxylic acid chloride.
| Compound Name | 1-cyclopropyl-7-(3-methylpiperazin-4-ium-1-yl)-6-nitro-4-oxoquinoline-3-carboxylic acid chloride |
|---|---|
| PubChem CID | 44657302 |
| Molecular Formula | C18H21ClN4O5 |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 1-cyclopropyl-7-(3-methylpiperazin-4-ium-1-yl)-6-nitro-4-oxoquinoline-3-carboxylic acid chloride |
| SMILES | CC1CN(c2cc3c(cc2[N+](=O)[O-])c(=O)c(C(=O)O)cn3C2CC2)CC[NH2+]1.[Cl-] |
| InChI | InChI=1S/C18H20N4O5.ClH/c1-10-8-20(5-4-19-10)15-7-14-12(6-16(15)22(26)27)17(23)13(18(24)25)9-21(14)11-2-3-11;/h6-7,9-11,19H,2-5,8H2,1H3,(H,24,25);1H |
| InChIKey | DDUQUTYCUZNRRS-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|