C12H15BrClN3O2 — CID 137377429
(2S)-4-(4-bromo-5-chloro-2-nitrophenyl)-1,2-dimethylpiperazine (PubChem CID 137377429) has the molecular formula C12H15BrClN3O2 and a molecular weight of 348.63 g/mol. Its IUPAC name is (2S)-4-(4-bromo-5-chloro-2-nitrophenyl)-1,2-dimethylpiperazine.
| Compound Name | (2S)-4-(4-bromo-5-chloro-2-nitrophenyl)-1,2-dimethylpiperazine |
|---|---|
| PubChem CID | 137377429 |
| Molecular Formula | C12H15BrClN3O2 |
| Molecular Weight | 348.63 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | (2S)-4-(4-bromo-5-chloro-2-nitrophenyl)-1,2-dimethylpiperazine |
| SMILES | C[C@H]1CN(c2cc(Cl)c(Br)cc2[N+](=O)[O-])CCN1C |
| InChI | InChI=1S/C12H15BrClN3O2/c1-8-7-16(4-3-15(8)2)11-6-10(14)9(13)5-12(11)17(18)19/h5-6,8H,3-4,7H2,1-2H3/t8-/m0/s1 |
| InChIKey | WANVLAVLNSLAJT-QMMMGPOBSA-N |
| XLogP | 3.15 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.63 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|