C16H17BrClFN6O2 — CID 169052129
N-[3-bromo-6-[(3S)-3,4-dimethylpiperazin-1-yl]-2-fluorophenyl]-6-chloro-5-nitropyrimidin-4-amine (PubChem CID 169052129) has the molecular formula C16H17BrClFN6O2 and a molecular weight of 459.71 g/mol. Its IUPAC name is N-[3-bromo-6-[(3S)-3,4-dimethylpiperazin-1-yl]-2-fluorophenyl]-6-chloro-5-nitropyrimidin-4-amine.
| Compound Name | N-[3-bromo-6-[(3S)-3,4-dimethylpiperazin-1-yl]-2-fluorophenyl]-6-chloro-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 169052129 |
| Molecular Formula | C16H17BrClFN6O2 |
| Molecular Weight | 459.71 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | N-[3-bromo-6-[(3S)-3,4-dimethylpiperazin-1-yl]-2-fluorophenyl]-6-chloro-5-nitropyrimidin-4-amine |
| SMILES | C[C@H]1CN(c2ccc(Br)c(F)c2Nc2ncnc(Cl)c2[N+](=O)[O-])CCN1C |
| InChI | InChI=1S/C16H17BrClFN6O2/c1-9-7-24(6-5-23(9)2)11-4-3-10(17)12(19)13(11)22-16-14(25(26)27)15(18)20-8-21-16/h3-4,8-9H,5-7H2,1-2H3,(H,20,21,22)/t9-/m0/s1 |
| InChIKey | LWKYDDAXDVBQFK-VIFPVBQESA-N |
| XLogP | 3.82 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.71 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|