C13H17BrFN3O2 — CID 169052268
(2R,6S)-4-(4-bromo-3-fluoro-2-nitrophenyl)-1,2,6-trimethylpiperazine (PubChem CID 169052268) has the molecular formula C13H17BrFN3O2 and a molecular weight of 346.20 g/mol. Its IUPAC name is (2R,6S)-4-(4-bromo-3-fluoro-2-nitrophenyl)-1,2,6-trimethylpiperazine.
| Compound Name | (2R,6S)-4-(4-bromo-3-fluoro-2-nitrophenyl)-1,2,6-trimethylpiperazine |
|---|---|
| PubChem CID | 169052268 |
| Molecular Formula | C13H17BrFN3O2 |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | (2R,6S)-4-(4-bromo-3-fluoro-2-nitrophenyl)-1,2,6-trimethylpiperazine |
| SMILES | C[C@@H]1CN(c2ccc(Br)c(F)c2[N+](=O)[O-])C[C@H](C)N1C |
| InChI | InChI=1S/C13H17BrFN3O2/c1-8-6-17(7-9(2)16(8)3)11-5-4-10(14)12(15)13(11)18(19)20/h4-5,8-9H,6-7H2,1-3H3/t8-,9+ |
| InChIKey | LPYUKUZVMYIVRU-DTORHVGOSA-N |
| XLogP | 3.03 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|