C13H16BrF2N3O2 — CID 138458150
4-(4-bromo-3,5-difluoro-2-nitrophenyl)-1,2,6-trimethylpiperazine (PubChem CID 138458150) has the molecular formula C13H16BrF2N3O2 and a molecular weight of 364.19 g/mol. Its IUPAC name is 4-(4-bromo-3,5-difluoro-2-nitrophenyl)-1,2,6-trimethylpiperazine.
| Compound Name | 4-(4-bromo-3,5-difluoro-2-nitrophenyl)-1,2,6-trimethylpiperazine |
|---|---|
| PubChem CID | 138458150 |
| Molecular Formula | C13H16BrF2N3O2 |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 4-(4-bromo-3,5-difluoro-2-nitrophenyl)-1,2,6-trimethylpiperazine |
| SMILES | CC1CN(c2cc(F)c(Br)c(F)c2[N+](=O)[O-])CC(C)N1C |
| InChI | InChI=1S/C13H16BrF2N3O2/c1-7-5-18(6-8(2)17(7)3)10-4-9(15)11(14)12(16)13(10)19(20)21/h4,7-8H,5-6H2,1-3H3 |
| InChIKey | SGYLFFDZEVWXSZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|