C20H17F2N3O4 — CID 5270917
1-(4-amino-2-fluorophenyl)-6-fluoro-7-morpholin-4-yl-4-oxoquinoline-3-carboxylic acid (PubChem CID 5270917) has the molecular formula C20H17F2N3O4 and a molecular weight of 401.37 g/mol. Its IUPAC name is 1-(4-amino-2-fluorophenyl)-6-fluoro-7-morpholin-4-yl-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-(4-amino-2-fluorophenyl)-6-fluoro-7-morpholin-4-yl-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 5270917 |
| Molecular Formula | C20H17F2N3O4 |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 1-(4-amino-2-fluorophenyl)-6-fluoro-7-morpholin-4-yl-4-oxoquinoline-3-carboxylic acid |
| SMILES | Nc1ccc(-n2cc(C(=O)O)c(=O)c3cc(F)c(N4CCOCC4)cc32)c(F)c1 |
| InChI | InChI=1S/C20H17F2N3O4/c21-14-7-11(23)1-2-16(14)25-10-13(20(27)28)19(26)12-8-15(22)18(9-17(12)25)24-3-5-29-6-4-24/h1-2,7-10H,3-6,23H2,(H,27,28) |
| InChIKey | DUSOUVINDDTSGZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|