C15H11F3NO4- — CID 86616056
5,6,7-trifluoro-1-(oxan-4-yl)-4-oxoquinoline-3-carboxylate (PubChem CID 86616056) has the molecular formula C15H11F3NO4- and a molecular weight of 326.25 g/mol. Its IUPAC name is 5,6,7-trifluoro-1-(oxan-4-yl)-4-oxoquinoline-3-carboxylate.
| Compound Name | 5,6,7-trifluoro-1-(oxan-4-yl)-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 86616056 |
| Molecular Formula | C15H11F3NO4- |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 5,6,7-trifluoro-1-(oxan-4-yl)-4-oxoquinoline-3-carboxylate |
| SMILES | O=C([O-])c1cn(C2CCOCC2)c2cc(F)c(F)c(F)c2c1=O |
| InChI | InChI=1S/C15H12F3NO4/c16-9-5-10-11(13(18)12(9)17)14(20)8(15(21)22)6-19(10)7-1-3-23-4-2-7/h5-7H,1-4H2,(H,21,22)/p-1 |
| InChIKey | GYOQWPIRZITTQP-UHFFFAOYSA-M |
| XLogP | 1.13 |
| TPSA | 71.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|