C14H14N2O4S — CID 123629000
1-cyclopropyl-6,7-dihydroxy-N-methylsulfanyl-4-oxoquinoline-3-carboxamide (PubChem CID 123629000) has the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. Its IUPAC name is 1-cyclopropyl-6,7-dihydroxy-N-methylsulfanyl-4-oxoquinoline-3-carboxamide.
| Compound Name | 1-cyclopropyl-6,7-dihydroxy-N-methylsulfanyl-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 123629000 |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 1-cyclopropyl-6,7-dihydroxy-N-methylsulfanyl-4-oxoquinoline-3-carboxamide |
| SMILES | CSNC(=O)c1cn(C2CC2)c2cc(O)c(O)cc2c1=O |
| InChI | InChI=1S/C14H14N2O4S/c1-21-15-14(20)9-6-16(7-2-3-7)10-5-12(18)11(17)4-8(10)13(9)19/h4-7,17-18H,2-3H2,1H3,(H,15,20) |
| InChIKey | WXJFXBDSPQBDRW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|