C15H17FN3O3+ — CID 118985532
2-[(3-carboxy-1-cyclopropyl-6-fluoro-4-oxoquinolin-7-yl)amino]ethylazanium (PubChem CID 118985532) has the molecular formula C15H17FN3O3+ and a molecular weight of 306.32 g/mol. Its IUPAC name is 2-[(3-carboxy-1-cyclopropyl-6-fluoro-4-oxoquinolin-7-yl)amino]ethylazanium.
| Compound Name | 2-[(3-carboxy-1-cyclopropyl-6-fluoro-4-oxoquinolin-7-yl)amino]ethylazanium |
|---|---|
| PubChem CID | 118985532 |
| Molecular Formula | C15H17FN3O3+ |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-[(3-carboxy-1-cyclopropyl-6-fluoro-4-oxoquinolin-7-yl)amino]ethylazanium |
| SMILES | [NH3+]CCNc1cc2c(cc1F)c(=O)c(C(=O)O)cn2C1CC1 |
| InChI | InChI=1S/C15H16FN3O3/c16-11-5-9-13(6-12(11)18-4-3-17)19(8-1-2-8)7-10(14(9)20)15(21)22/h5-8,18H,1-4,17H2,(H,21,22)/p+1 |
| InChIKey | ZYLULTURYPAERI-UHFFFAOYSA-O |
| XLogP | 0.83 |
| TPSA | 98.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |