C20H23FN2O4 — CID 118619689
1-cyclopentyl-6-fluoro-7-(oxan-3-ylamino)-4-oxoquinoline-3-carboxylic acid (PubChem CID 118619689) has the molecular formula C20H23FN2O4 and a molecular weight of 374.41 g/mol. Its IUPAC name is 1-cyclopentyl-6-fluoro-7-(oxan-3-ylamino)-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopentyl-6-fluoro-7-(oxan-3-ylamino)-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 118619689 |
| Molecular Formula | C20H23FN2O4 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 1-cyclopentyl-6-fluoro-7-(oxan-3-ylamino)-4-oxoquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(C2CCCC2)c2cc(NC3CCCOC3)c(F)cc2c1=O |
| InChI | InChI=1S/C20H23FN2O4/c21-16-8-14-18(9-17(16)22-12-4-3-7-27-11-12)23(13-5-1-2-6-13)10-15(19(14)24)20(25)26/h8-10,12-13,22H,1-7,11H2,(H,25,26) |
| InChIKey | PDJIORUAUDKJDJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |