C20H24FN3O3 — CID 150179225
7-(cyclohexylamino)-6-fluoro-1-(1-methylazetidin-3-yl)-4-oxoquinoline-3-carboxylic acid (PubChem CID 150179225) has the molecular formula C20H24FN3O3 and a molecular weight of 373.43 g/mol. Its IUPAC name is 7-(cyclohexylamino)-6-fluoro-1-(1-methylazetidin-3-yl)-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-(cyclohexylamino)-6-fluoro-1-(1-methylazetidin-3-yl)-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 150179225 |
| Molecular Formula | C20H24FN3O3 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 7-(cyclohexylamino)-6-fluoro-1-(1-methylazetidin-3-yl)-4-oxoquinoline-3-carboxylic acid |
| SMILES | CN1CC(n2cc(C(=O)O)c(=O)c3cc(F)c(NC4CCCCC4)cc32)C1 |
| InChI | InChI=1S/C20H24FN3O3/c1-23-9-13(10-23)24-11-15(20(26)27)19(25)14-7-16(21)17(8-18(14)24)22-12-5-3-2-4-6-12/h7-8,11-13,22H,2-6,9-10H2,1H3,(H,26,27) |
| InChIKey | FLBGFIZFOVCRFN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |