C23H30FN3O6S — CID 11409327
2-[[7-(cyclohexylamino)-1-cyclopentyl-6-fluoro-4-oxoquinoline-3-carbonyl]amino]ethyl hydrogen sulfate (PubChem CID 11409327) has the molecular formula C23H30FN3O6S and a molecular weight of 495.57 g/mol. Its IUPAC name is 2-[[7-(cyclohexylamino)-1-cyclopentyl-6-fluoro-4-oxoquinoline-3-carbonyl]amino]ethyl hydrogen sulfate.
| Compound Name | 2-[[7-(cyclohexylamino)-1-cyclopentyl-6-fluoro-4-oxoquinoline-3-carbonyl]amino]ethyl hydrogen sulfate |
|---|---|
| PubChem CID | 11409327 |
| Molecular Formula | C23H30FN3O6S |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 2-[[7-(cyclohexylamino)-1-cyclopentyl-6-fluoro-4-oxoquinoline-3-carbonyl]amino]ethyl hydrogen sulfate |
| SMILES | O=C(NCCOS(=O)(=O)O)c1cn(C2CCCC2)c2cc(NC3CCCCC3)c(F)cc2c1=O |
| InChI | InChI=1S/C23H30FN3O6S/c24-19-12-17-21(13-20(19)26-15-6-2-1-3-7-15)27(16-8-4-5-9-16)14-18(22(17)28)23(29)25-10-11-33-34(30,31)32/h12-16,26H,1-11H2,(H,25,29)(H,30,31,32) |
| InChIKey | CWMQXXZZRAEBEC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 126.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|