C14H14N2O5 — CID 151974709
1-cyclopropyl-6,7-dimethoxy-5-nitroquinolin-4-one (PubChem CID 151974709) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is 1-cyclopropyl-6,7-dimethoxy-5-nitroquinolin-4-one.
| Compound Name | 1-cyclopropyl-6,7-dimethoxy-5-nitroquinolin-4-one |
|---|---|
| PubChem CID | 151974709 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 1-cyclopropyl-6,7-dimethoxy-5-nitroquinolin-4-one |
| SMILES | COc1cc2c(c([N+](=O)[O-])c1OC)c(=O)ccn2C1CC1 |
| InChI | InChI=1S/C14H14N2O5/c1-20-11-7-9-12(13(16(18)19)14(11)21-2)10(17)5-6-15(9)8-3-4-8/h5-8H,3-4H2,1-2H3 |
| InChIKey | UBKORFIFWWAFPP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 83.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|