C21H22FN3O9 — CID 23154662
dimethyl 2-[(1-cyclopropyl-6-fluoro-3-methoxycarbonyl-8-nitro-4-oxoquinolin-7-yl)amino]pentanedioate (PubChem CID 23154662) has the molecular formula C21H22FN3O9 and a molecular weight of 479.42 g/mol. Its IUPAC name is dimethyl 2-[(1-cyclopropyl-6-fluoro-3-methoxycarbonyl-8-nitro-4-oxoquinolin-7-yl)amino]pentanedioate.
| Compound Name | dimethyl 2-[(1-cyclopropyl-6-fluoro-3-methoxycarbonyl-8-nitro-4-oxoquinolin-7-yl)amino]pentanedioate |
|---|---|
| PubChem CID | 23154662 |
| Molecular Formula | C21H22FN3O9 |
| Molecular Weight | 479.42 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | dimethyl 2-[(1-cyclopropyl-6-fluoro-3-methoxycarbonyl-8-nitro-4-oxoquinolin-7-yl)amino]pentanedioate |
| SMILES | COC(=O)CCC(Nc1c(F)cc2c(=O)c(C(=O)OC)cn(C3CC3)c2c1[N+](=O)[O-])C(=O)OC |
| InChI | InChI=1S/C21H22FN3O9/c1-32-15(26)7-6-14(21(29)34-3)23-16-13(22)8-11-17(18(16)25(30)31)24(10-4-5-10)9-12(19(11)27)20(28)33-2/h8-10,14,23H,4-7H2,1-3H3 |
| InChIKey | NQUBUHINSHFMDE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 156.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|