C20H20FN3O9 — CID 23154660
dimethyl 2-[(1-cyclopropyl-6-fluoro-3-methoxycarbonyl-8-nitro-4-oxoquinolin-7-yl)amino]butanedioate (PubChem CID 23154660) has the molecular formula C20H20FN3O9 and a molecular weight of 465.39 g/mol. Its IUPAC name is dimethyl 2-[(1-cyclopropyl-6-fluoro-3-methoxycarbonyl-8-nitro-4-oxoquinolin-7-yl)amino]butanedioate.
| Compound Name | dimethyl 2-[(1-cyclopropyl-6-fluoro-3-methoxycarbonyl-8-nitro-4-oxoquinolin-7-yl)amino]butanedioate |
|---|---|
| PubChem CID | 23154660 |
| Molecular Formula | C20H20FN3O9 |
| Molecular Weight | 465.39 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | dimethyl 2-[(1-cyclopropyl-6-fluoro-3-methoxycarbonyl-8-nitro-4-oxoquinolin-7-yl)amino]butanedioate |
| SMILES | COC(=O)CC(Nc1c(F)cc2c(=O)c(C(=O)OC)cn(C3CC3)c2c1[N+](=O)[O-])C(=O)OC |
| InChI | InChI=1S/C20H20FN3O9/c1-31-14(25)7-13(20(28)33-3)22-15-12(21)6-10-16(17(15)24(29)30)23(9-4-5-9)8-11(18(10)26)19(27)32-2/h6,8-9,13,22H,4-5,7H2,1-3H3 |
| InChIKey | RBQAOVASPXWIHU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 156.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|