C21H23FN4O8 — CID 23154651
7-[(5-acetamido-1-carboxypentyl)amino]-1-cyclopropyl-6-fluoro-8-nitro-4-oxoquinoline-3-carboxylic acid (PubChem CID 23154651) has the molecular formula C21H23FN4O8 and a molecular weight of 478.43 g/mol. Its IUPAC name is 7-[(5-acetamido-1-carboxypentyl)amino]-1-cyclopropyl-6-fluoro-8-nitro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-[(5-acetamido-1-carboxypentyl)amino]-1-cyclopropyl-6-fluoro-8-nitro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 23154651 |
| Molecular Formula | C21H23FN4O8 |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 7-[(5-acetamido-1-carboxypentyl)amino]-1-cyclopropyl-6-fluoro-8-nitro-4-oxoquinoline-3-carboxylic acid |
| SMILES | CC(=O)NCCCCC(Nc1c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c2c1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C21H23FN4O8/c1-10(27)23-7-3-2-4-15(21(31)32)24-16-14(22)8-12-17(18(16)26(33)34)25(11-5-6-11)9-13(19(12)28)20(29)30/h8-9,11,15,24H,2-7H2,1H3,(H,23,27)(H,29,30)(H,31,32) |
| InChIKey | KXVUCUBVZCLXCG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 180.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|