C17H15FN2O5 — CID 16639249
7-(1-cyano-2-ethoxy-2-oxoethyl)-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 16639249) has the molecular formula C17H15FN2O5 and a molecular weight of 346.31 g/mol. Its IUPAC name is 7-(1-cyano-2-ethoxy-2-oxoethyl)-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-(1-cyano-2-ethoxy-2-oxoethyl)-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 16639249 |
| Molecular Formula | C17H15FN2O5 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 7-(1-cyano-2-ethoxy-2-oxoethyl)-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCOC(=O)C(C#N)c1cc2c(cc1F)c(=O)c(C(=O)O)cn2CC |
| InChI | InChI=1S/C17H15FN2O5/c1-3-20-8-12(16(22)23)15(21)10-5-13(18)9(6-14(10)20)11(7-19)17(24)25-4-2/h5-6,8,11H,3-4H2,1-2H3,(H,22,23) |
| InChIKey | ROCBHYPSNVFFEG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |