C12H8F2N2O2 — CID 119088945
ethyl 2-cyano-2-(4-cyano-2,5-difluorophenyl)acetate (PubChem CID 119088945) has the molecular formula C12H8F2N2O2 and a molecular weight of 250.20 g/mol. Its IUPAC name is ethyl 2-cyano-2-(4-cyano-2,5-difluorophenyl)acetate.
| Compound Name | ethyl 2-cyano-2-(4-cyano-2,5-difluorophenyl)acetate |
|---|---|
| PubChem CID | 119088945 |
| Molecular Formula | C12H8F2N2O2 |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | ethyl 2-cyano-2-(4-cyano-2,5-difluorophenyl)acetate |
| SMILES | CCOC(=O)C(C#N)c1cc(F)c(C#N)cc1F |
| InChI | InChI=1S/C12H8F2N2O2/c1-2-18-12(17)9(6-16)8-4-10(13)7(5-15)3-11(8)14/h3-4,9H,2H2,1H3 |
| InChIKey | GEYBNDKHAVPMFR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |