C11H8F2N2O3 — CID 169035978
ethyl 2-(5-cyano-2,4-difluoroanilino)-2-oxoacetate (PubChem CID 169035978) has the molecular formula C11H8F2N2O3 and a molecular weight of 254.19 g/mol. Its IUPAC name is ethyl 2-(5-cyano-2,4-difluoroanilino)-2-oxoacetate.
| Compound Name | ethyl 2-(5-cyano-2,4-difluoroanilino)-2-oxoacetate |
|---|---|
| PubChem CID | 169035978 |
| Molecular Formula | C11H8F2N2O3 |
| Molecular Weight | 254.19 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | ethyl 2-(5-cyano-2,4-difluoroanilino)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1cc(C#N)c(F)cc1F |
| InChI | InChI=1S/C11H8F2N2O3/c1-2-18-11(17)10(16)15-9-3-6(5-14)7(12)4-8(9)13/h3-4H,2H2,1H3,(H,15,16) |
| InChIKey | YTFBQKKPIMTDNX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.19 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|