C11H10F2N2O3 — CID 161439798
ethyl N-(4-cyano-2,5-difluorophenoxy)-N-methylcarbamate (PubChem CID 161439798) has the molecular formula C11H10F2N2O3 and a molecular weight of 256.21 g/mol. Its IUPAC name is ethyl N-(4-cyano-2,5-difluorophenoxy)-N-methylcarbamate.
| Compound Name | ethyl N-(4-cyano-2,5-difluorophenoxy)-N-methylcarbamate |
|---|---|
| PubChem CID | 161439798 |
| Molecular Formula | C11H10F2N2O3 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | ethyl N-(4-cyano-2,5-difluorophenoxy)-N-methylcarbamate |
| SMILES | CCOC(=O)N(C)Oc1cc(F)c(C#N)cc1F |
| InChI | InChI=1S/C11H10F2N2O3/c1-3-17-11(16)15(2)18-10-5-8(12)7(6-14)4-9(10)13/h4-5H,3H2,1-2H3 |
| InChIKey | VZCUQLQSNPRMHN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|