C18H9F6NO3 — CID 15070037
ethyl 1-(2,4-difluorophenyl)-5,6,7,8-tetrafluoro-4-oxoquinoline-3-carboxylate (PubChem CID 15070037) has the molecular formula C18H9F6NO3 and a molecular weight of 401.26 g/mol. Its IUPAC name is ethyl 1-(2,4-difluorophenyl)-5,6,7,8-tetrafluoro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-(2,4-difluorophenyl)-5,6,7,8-tetrafluoro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 15070037 |
| Molecular Formula | C18H9F6NO3 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | ethyl 1-(2,4-difluorophenyl)-5,6,7,8-tetrafluoro-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2ccc(F)cc2F)c2c(F)c(F)c(F)c(F)c2c1=O |
| InChI | InChI=1S/C18H9F6NO3/c1-2-28-18(27)8-6-25(10-4-3-7(19)5-9(10)20)16-11(17(8)26)12(21)13(22)14(23)15(16)24/h3-6H,2H2,1H3 |
| InChIKey | QMZLCHBVQNZKKS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|