C21H21F2NO7 — CID 22167267
diethyl 2-(1-ethenyl-3-ethoxycarbonyl-6,8-difluoro-4-oxoquinolin-7-yl)propanedioate (PubChem CID 22167267) has the molecular formula C21H21F2NO7 and a molecular weight of 437.40 g/mol. Its IUPAC name is diethyl 2-(1-ethenyl-3-ethoxycarbonyl-6,8-difluoro-4-oxoquinolin-7-yl)propanedioate.
| Compound Name | diethyl 2-(1-ethenyl-3-ethoxycarbonyl-6,8-difluoro-4-oxoquinolin-7-yl)propanedioate |
|---|---|
| PubChem CID | 22167267 |
| Molecular Formula | C21H21F2NO7 |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | diethyl 2-(1-ethenyl-3-ethoxycarbonyl-6,8-difluoro-4-oxoquinolin-7-yl)propanedioate |
| SMILES | C=Cn1cc(C(=O)OCC)c(=O)c2cc(F)c(C(C(=O)OCC)C(=O)OCC)c(F)c21 |
| InChI | InChI=1S/C21H21F2NO7/c1-5-24-10-12(19(26)29-6-2)18(25)11-9-13(22)14(16(23)17(11)24)15(20(27)30-7-3)21(28)31-8-4/h5,9-10,15H,1,6-8H2,2-4H3 |
| InChIKey | ZBTOOBIMOUUCCP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|