C25H23F2NO7 — CID 22167213
diethyl 2-(3-ethoxycarbonyl-6,8-difluoro-4-oxo-1-phenylquinolin-7-yl)propanedioate (PubChem CID 22167213) has the molecular formula C25H23F2NO7 and a molecular weight of 487.46 g/mol. Its IUPAC name is diethyl 2-(3-ethoxycarbonyl-6,8-difluoro-4-oxo-1-phenylquinolin-7-yl)propanedioate.
| Compound Name | diethyl 2-(3-ethoxycarbonyl-6,8-difluoro-4-oxo-1-phenylquinolin-7-yl)propanedioate |
|---|---|
| PubChem CID | 22167213 |
| Molecular Formula | C25H23F2NO7 |
| Molecular Weight | 487.46 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | diethyl 2-(3-ethoxycarbonyl-6,8-difluoro-4-oxo-1-phenylquinolin-7-yl)propanedioate |
| SMILES | CCOC(=O)c1cn(-c2ccccc2)c2c(F)c(C(C(=O)OCC)C(=O)OCC)c(F)cc2c1=O |
| InChI | InChI=1S/C25H23F2NO7/c1-4-33-23(30)16-13-28(14-10-8-7-9-11-14)21-15(22(16)29)12-17(26)18(20(21)27)19(24(31)34-5-2)25(32)35-6-3/h7-13,19H,4-6H2,1-3H3 |
| InChIKey | WZNWSANDLVNATO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|