C22H17F4NO6S — CID 134879802
2-(3-ethoxycarbonyl-6,7,8-trifluoro-4-oxoquinolin-1-yl)-3-fluoro-3-(4-methoxyphenyl)sulfanylpropanoic acid (PubChem CID 134879802) has the molecular formula C22H17F4NO6S and a molecular weight of 499.44 g/mol. Its IUPAC name is 2-(3-ethoxycarbonyl-6,7,8-trifluoro-4-oxoquinolin-1-yl)-3-fluoro-3-(4-methoxyphenyl)sulfanylpropanoic acid.
| Compound Name | 2-(3-ethoxycarbonyl-6,7,8-trifluoro-4-oxoquinolin-1-yl)-3-fluoro-3-(4-methoxyphenyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 134879802 |
| Molecular Formula | C22H17F4NO6S |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | 2-(3-ethoxycarbonyl-6,7,8-trifluoro-4-oxoquinolin-1-yl)-3-fluoro-3-(4-methoxyphenyl)sulfanylpropanoic acid |
| SMILES | CCOC(=O)c1cn(C(C(=O)O)C(F)Sc2ccc(OC)cc2)c2c(F)c(F)c(F)cc2c1=O |
| InChI | InChI=1S/C22H17F4NO6S/c1-3-33-22(31)13-9-27(17-12(19(13)28)8-14(23)15(24)16(17)25)18(21(29)30)20(26)34-11-6-4-10(32-2)5-7-11/h4-9,18,20H,3H2,1-2H3,(H,29,30) |
| InChIKey | YYZAVPIQRHMBKW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|