C18H18N2O3S — CID 10088750
ethyl 1-ethyl-7-(2-methyl-1,3-thiazol-5-yl)-4-oxoquinoline-3-carboxylate (PubChem CID 10088750) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is ethyl 1-ethyl-7-(2-methyl-1,3-thiazol-5-yl)-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-ethyl-7-(2-methyl-1,3-thiazol-5-yl)-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 10088750 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | ethyl 1-ethyl-7-(2-methyl-1,3-thiazol-5-yl)-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(CC)c2cc(-c3cnc(C)s3)ccc2c1=O |
| InChI | InChI=1S/C18H18N2O3S/c1-4-20-10-14(18(22)23-5-2)17(21)13-7-6-12(8-15(13)20)16-9-19-11(3)24-16/h6-10H,4-5H2,1-3H3 |
| InChIKey | IIUCXFJSWRIXIY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|