C19H26NO6P — CID 62707271
ethyl 1-[di(propan-2-yloxy)phosphorylmethyl]-4-oxoquinoline-3-carboxylate (PubChem CID 62707271) has the molecular formula C19H26NO6P and a molecular weight of 395.39 g/mol. Its IUPAC name is ethyl 1-[di(propan-2-yloxy)phosphorylmethyl]-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-[di(propan-2-yloxy)phosphorylmethyl]-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 62707271 |
| Molecular Formula | C19H26NO6P |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | ethyl 1-[di(propan-2-yloxy)phosphorylmethyl]-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(CP(=O)(OC(C)C)OC(C)C)c2ccccc2c1=O |
| InChI | InChI=1S/C19H26NO6P/c1-6-24-19(22)16-11-20(17-10-8-7-9-15(17)18(16)21)12-27(23,25-13(2)3)26-14(4)5/h7-11,13-14H,6,12H2,1-5H3 |
| InChIKey | MZTXHMPNYPFKFW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|