C15H24NO6P — CID 101492809
ethyl 1-[di(propan-2-yloxy)phosphorylmethyl]-4-oxopyridine-2-carboxylate (PubChem CID 101492809) has the molecular formula C15H24NO6P and a molecular weight of 345.33 g/mol. Its IUPAC name is ethyl 1-[di(propan-2-yloxy)phosphorylmethyl]-4-oxopyridine-2-carboxylate.
| Compound Name | ethyl 1-[di(propan-2-yloxy)phosphorylmethyl]-4-oxopyridine-2-carboxylate |
|---|---|
| PubChem CID | 101492809 |
| Molecular Formula | C15H24NO6P |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | ethyl 1-[di(propan-2-yloxy)phosphorylmethyl]-4-oxopyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)ccn1CP(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C15H24NO6P/c1-6-20-15(18)14-9-13(17)7-8-16(14)10-23(19,21-11(2)3)22-12(4)5/h7-9,11-12H,6,10H2,1-5H3 |
| InChIKey | YXNABFVNEAPNOT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|