C27H21N3O9 — CID 14261776
1-O-[2,2-bis(4-nitrophenyl)ethyl] 3-O-ethyl 4-oxoquinoline-1,3-dicarboxylate (PubChem CID 14261776) has the molecular formula C27H21N3O9 and a molecular weight of 531.48 g/mol. Its IUPAC name is 1-O-[2,2-bis(4-nitrophenyl)ethyl] 3-O-ethyl 4-oxoquinoline-1,3-dicarboxylate.
| Compound Name | 1-O-[2,2-bis(4-nitrophenyl)ethyl] 3-O-ethyl 4-oxoquinoline-1,3-dicarboxylate |
|---|---|
| PubChem CID | 14261776 |
| Molecular Formula | C27H21N3O9 |
| Molecular Weight | 531.48 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | 1-O-[2,2-bis(4-nitrophenyl)ethyl] 3-O-ethyl 4-oxoquinoline-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cn(C(=O)OCC(c2ccc([N+](=O)[O-])cc2)c2ccc([N+](=O)[O-])cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C27H21N3O9/c1-2-38-26(32)22-15-28(24-6-4-3-5-21(24)25(22)31)27(33)39-16-23(17-7-11-19(12-8-17)29(34)35)18-9-13-20(14-10-18)30(36)37/h3-15,23H,2,16H2,1H3 |
| InChIKey | WEQZOWWQYKQKAY-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 160.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|