C17H10ClF4N3O3 — CID 54318442
ethyl 1-(5-amino-2,3,4-trifluorophenyl)-7-chloro-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate (PubChem CID 54318442) has the molecular formula C17H10ClF4N3O3 and a molecular weight of 415.73 g/mol. Its IUPAC name is ethyl 1-(5-amino-2,3,4-trifluorophenyl)-7-chloro-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate.
| Compound Name | ethyl 1-(5-amino-2,3,4-trifluorophenyl)-7-chloro-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 54318442 |
| Molecular Formula | C17H10ClF4N3O3 |
| Molecular Weight | 415.73 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | ethyl 1-(5-amino-2,3,4-trifluorophenyl)-7-chloro-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2cc(N)c(F)c(F)c2F)c2nc(Cl)c(F)cc2c1=O |
| InChI | InChI=1S/C17H10ClF4N3O3/c1-2-28-17(27)7-5-25(10-4-9(23)11(20)13(22)12(10)21)16-6(14(7)26)3-8(19)15(18)24-16/h3-5H,2,23H2,1H3 |
| InChIKey | SPWSZNAXRLIERY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.73 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|