C14H9ClFN3O3S — CID 142434761
ethyl 7-chloro-1-(5-fluoro-1,3-thiazol-2-yl)-4-oxo-1,8-naphthyridine-3-carboxylate (PubChem CID 142434761) has the molecular formula C14H9ClFN3O3S and a molecular weight of 353.76 g/mol. Its IUPAC name is ethyl 7-chloro-1-(5-fluoro-1,3-thiazol-2-yl)-4-oxo-1,8-naphthyridine-3-carboxylate.
| Compound Name | ethyl 7-chloro-1-(5-fluoro-1,3-thiazol-2-yl)-4-oxo-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 142434761 |
| Molecular Formula | C14H9ClFN3O3S |
| Molecular Weight | 353.76 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | ethyl 7-chloro-1-(5-fluoro-1,3-thiazol-2-yl)-4-oxo-1,8-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2ncc(F)s2)c2nc(Cl)ccc2c1=O |
| InChI | InChI=1S/C14H9ClFN3O3S/c1-2-22-13(21)8-6-19(14-17-5-10(16)23-14)12-7(11(8)20)3-4-9(15)18-12/h3-6H,2H2,1H3 |
| InChIKey | AILXWPUFPAWVLS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.76 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|