About ethyl 2-methylsulfanyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate
ethyl 2-methylsulfanyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 11002551) has the molecular formula C14H12N4O3S2
and a molecular weight of 348.41 g/mol. Its IUPAC name is ethyl 2-methylsulfanyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-methylsulfanyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate |
| PubChem CID | 11002551 |
| Molecular Formula | C14H12N4O3S2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | ethyl 2-methylsulfanyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2nccs2)c2nc(SC)ncc2c1=O |
| InChI | InChI=1S/C14H12N4O3S2/c1-3-21-12(20)9-7-18(14-15-4-5-23-14)11-8(10(9)19)6-16-13(17-11)22-2/h4-7H,3H2,1-2H3 |
| InChIKey | VHQFNZVWWPVLAR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze ethyl 2-methylsulfanyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methylsulfanyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate?
The IUPAC name of ethyl 2-methylsulfanyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate (CID 11002551) is ethyl 2-methylsulfanyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate.
What is the SMILES notation for ethyl 2-methylsulfanyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate?
The canonical SMILES for ethyl 2-methylsulfanyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate is CCOC(=O)c1cn(-c2nccs2)c2nc(SC)ncc2c1=O.
What is the InChIKey of ethyl 2-methylsulfanyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate?
The InChIKey is VHQFNZVWWPVLAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O3S2/c1-3-21-12(20)9-7-18(14-15-4-5-23-14)11-8(10(9)19)6-16-13(17-11)22-2/h4-7H,3H2,1-2H3.
What are the key properties of ethyl 2-methylsulfanyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate?
ethyl 2-methylsulfanyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate has a molecular weight of 348.41 g/mol, XLogP of 2.14, 4 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methylsulfanyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate is sourced from PubChem (CID 11002551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).