C11H5ClN4O3S — CID 142435114
7-chloro-4-oxo-1-(1,2,4-thiadiazol-5-yl)-1,8-naphthyridine-3-carboxylic acid (PubChem CID 142435114) has the molecular formula C11H5ClN4O3S and a molecular weight of 308.71 g/mol. Its IUPAC name is 7-chloro-4-oxo-1-(1,2,4-thiadiazol-5-yl)-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 7-chloro-4-oxo-1-(1,2,4-thiadiazol-5-yl)-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 142435114 |
| Molecular Formula | C11H5ClN4O3S |
| Molecular Weight | 308.71 g/mol |
| Exact Mass | 307.98 |
| IUPAC Name | 7-chloro-4-oxo-1-(1,2,4-thiadiazol-5-yl)-1,8-naphthyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cn(-c2ncns2)c2nc(Cl)ccc2c1=O |
| InChI | InChI=1S/C11H5ClN4O3S/c12-7-2-1-5-8(17)6(10(18)19)3-16(9(5)15-7)11-13-4-14-20-11/h1-4H,(H,18,19) |
| InChIKey | JNACEJGBOAPKJO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.71 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|