C11H3Cl2FN4O3S — CID 142434431
7-chloro-1-(3-chloro-1,2,4-thiadiazol-5-yl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid (PubChem CID 142434431) has the molecular formula C11H3Cl2FN4O3S and a molecular weight of 361.14 g/mol. Its IUPAC name is 7-chloro-1-(3-chloro-1,2,4-thiadiazol-5-yl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 7-chloro-1-(3-chloro-1,2,4-thiadiazol-5-yl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 142434431 |
| Molecular Formula | C11H3Cl2FN4O3S |
| Molecular Weight | 361.14 g/mol |
| Exact Mass | 359.93 |
| IUPAC Name | 7-chloro-1-(3-chloro-1,2,4-thiadiazol-5-yl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cn(-c2nc(Cl)ns2)c2nc(Cl)c(F)cc2c1=O |
| InChI | InChI=1S/C11H3Cl2FN4O3S/c12-7-5(14)1-3-6(19)4(9(20)21)2-18(8(3)15-7)11-16-10(13)17-22-11/h1-2H,(H,20,21) |
| InChIKey | IIWYNQGECYBAHT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.14 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|