C12H5ClFN3O3S — CID 139649612
7-chloro-6-fluoro-4-oxo-1-(1,3-thiazol-5-yl)-1,8-naphthyridine-3-carboxylic acid (PubChem CID 139649612) has the molecular formula C12H5ClFN3O3S and a molecular weight of 325.71 g/mol. Its IUPAC name is 7-chloro-6-fluoro-4-oxo-1-(1,3-thiazol-5-yl)-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 7-chloro-6-fluoro-4-oxo-1-(1,3-thiazol-5-yl)-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 139649612 |
| Molecular Formula | C12H5ClFN3O3S |
| Molecular Weight | 325.71 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | 7-chloro-6-fluoro-4-oxo-1-(1,3-thiazol-5-yl)-1,8-naphthyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cn(-c2cncs2)c2nc(Cl)c(F)cc2c1=O |
| InChI | InChI=1S/C12H5ClFN3O3S/c13-10-7(14)1-5-9(18)6(12(19)20)3-17(11(5)16-10)8-2-15-4-21-8/h1-4H,(H,19,20) |
| InChIKey | KHWKSFMCSCQGIF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.71 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|