C13H5F3N2O3S — CID 11823570
6,7,8-trifluoro-4-oxo-1-(1,3-thiazol-2-yl)quinoline-3-carboxylic acid (PubChem CID 11823570) has the molecular formula C13H5F3N2O3S and a molecular weight of 326.26 g/mol. Its IUPAC name is 6,7,8-trifluoro-4-oxo-1-(1,3-thiazol-2-yl)quinoline-3-carboxylic acid.
| Compound Name | 6,7,8-trifluoro-4-oxo-1-(1,3-thiazol-2-yl)quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 11823570 |
| Molecular Formula | C13H5F3N2O3S |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | 6,7,8-trifluoro-4-oxo-1-(1,3-thiazol-2-yl)quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(-c2nccs2)c2c(F)c(F)c(F)cc2c1=O |
| InChI | InChI=1S/C13H5F3N2O3S/c14-7-3-5-10(9(16)8(7)15)18(13-17-1-2-22-13)4-6(11(5)19)12(20)21/h1-4H,(H,20,21) |
| InChIKey | HQBWJADHSCJJAS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|