C12H5Cl2N3O3S — CID 18969067
5,7-dichloro-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid (PubChem CID 18969067) has the molecular formula C12H5Cl2N3O3S and a molecular weight of 342.16 g/mol. Its IUPAC name is 5,7-dichloro-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 5,7-dichloro-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 18969067 |
| Molecular Formula | C12H5Cl2N3O3S |
| Molecular Weight | 342.16 g/mol |
| Exact Mass | 340.94 |
| IUPAC Name | 5,7-dichloro-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cn(-c2nccs2)c2nc(Cl)cc(Cl)c2c1=O |
| InChI | InChI=1S/C12H5Cl2N3O3S/c13-6-3-7(14)16-10-8(6)9(18)5(11(19)20)4-17(10)12-15-1-2-21-12/h1-4H,(H,19,20) |
| InChIKey | VXAWXRJDEKXMEN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.16 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|